Products 929971-67-5

CAS 929971-67-5 is the registry number for Oxolan-2-ylmethyl 4-chlorobenzene-1-sulfonate. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.

Structural formula: {0} (CAS {1})

Oxolan-2-ylmethyl 4-chlorobenzenesulfonate (CAS 929971-67-5) is a chemical compound with the molecular formula C11H13ClO4S and a molecular weight of 276.74 g/mol. IUPAC name: oxolan-2-ylmethyl 4-chlorobenzenesulfonate. InChIKey: SVZUCPOTYAPYJP-UHFFFAOYSA-N.

Identity
Molecular formulaC11H13ClO4S
Molecular weight276.74 g/mol
IUPAC nameoxolan-2-ylmethyl 4-chlorobenzenesulfonate
InChIKeySVZUCPOTYAPYJP-UHFFFAOYSA-N
SMILESC1CC(OC1)COS(=O)(=O)C2=CC=C(C=C2)Cl

Computed by PubChem (NCBI)