CAS 929971-67-5 is the registry number for Oxolan-2-ylmethyl 4-chlorobenzene-1-sulfonate. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.
Oxolan-2-ylmethyl 4-chlorobenzenesulfonate (CAS 929971-67-5) is a chemical compound with the molecular formula C11H13ClO4S and a molecular weight of 276.74 g/mol. IUPAC name: oxolan-2-ylmethyl 4-chlorobenzenesulfonate. InChIKey: SVZUCPOTYAPYJP-UHFFFAOYSA-N.
| Molecular formula | C11H13ClO4S |
|---|---|
| Molecular weight | 276.74 g/mol |
| IUPAC name | oxolan-2-ylmethyl 4-chlorobenzenesulfonate |
| InChIKey | SVZUCPOTYAPYJP-UHFFFAOYSA-N |
| SMILES | C1CC(OC1)COS(=O)(=O)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)