CAS 930017-01-9 is the registry number for E28362, 94.51%. Offered by: MedChemExpress. Available pack sizes: 50 mg, 25 mg, 100 mg, 10 mg, 5 mg.
6-(2-hydroxypropyl)-4-(4-methylphenyl)-1,3,4,7-tetrahydropyrrolo[3,4-d]pyrimidine-2,5-dione (CAS 930017-01-9) is a chemical compound with the molecular formula C16H19N3O3 and a molecular weight of 301.34 g/mol. IUPAC name: 6-(2-hydroxypropyl)-4-(4-methylphenyl)-1,3,4,7-tetrahydropyrrolo[3,4-d]pyrimidine-2,5-dione. InChIKey: FXSFMYTXKXGGCT-UHFFFAOYSA-N.
| Molecular formula | C16H19N3O3 |
|---|---|
| Molecular weight | 301.34 g/mol |
| IUPAC name | 6-(2-hydroxypropyl)-4-(4-methylphenyl)-1,3,4,7-tetrahydropyrrolo[3,4-d]pyrimidine-2,5-dione |
| InChIKey | FXSFMYTXKXGGCT-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2C3=C(CN(C3=O)CC(C)O)NC(=O)N2 |
Computed by PubChem (NCBI)