CAS 93033-58-0 appears in our catalog under these names: 3-(Benzyloxy)benzaldehyde oxime, 95%, N-{(3-(Benzyloxy)phenyl)methylidene}hydroxylamine. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 100mg, 5g, 1g, 0,5g.
(NE)-N-[(3-phenylmethoxyphenyl)methylidene]hydroxylamine (CAS 93033-58-0) is a chemical compound with the molecular formula C14H13NO2 and a molecular weight of 227.26 g/mol. IUPAC name: (NE)-N-[(3-phenylmethoxyphenyl)methylidene]hydroxylamine. InChIKey: YUQATBOXIFGNQR-XNTDXEJSSA-N.
| Molecular formula | C14H13NO2 |
|---|---|
| Molecular weight | 227.26 g/mol |
| IUPAC name | (NE)-N-[(3-phenylmethoxyphenyl)methylidene]hydroxylamine |
| InChIKey | YUQATBOXIFGNQR-XNTDXEJSSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC=CC(=C2)/C=N/O |
Computed by PubChem (NCBI)