CAS 930414-73-6 is the registry number for 5,5,5-Trifluoro-4-hydroxy-4-(1-methyl-1H-imidazol-2-yl)pentan-2-one, 95%. Offered by: AmBeed. Available pack sizes: 5g.
5,5,5-trifluoro-4-hydroxy-4-(1-methylimidazol-2-yl)pentan-2-one (CAS 930414-73-6) is a chemical compound with the molecular formula C9H11F3N2O2 and a molecular weight of 236.19 g/mol. IUPAC name: 5,5,5-trifluoro-4-hydroxy-4-(1-methylimidazol-2-yl)pentan-2-one. InChIKey: JIGAJAXVPYMJEG-UHFFFAOYSA-N.
| Molecular formula | C9H11F3N2O2 |
|---|---|
| Molecular weight | 236.19 g/mol |
| IUPAC name | 5,5,5-trifluoro-4-hydroxy-4-(1-methylimidazol-2-yl)pentan-2-one |
| InChIKey | JIGAJAXVPYMJEG-UHFFFAOYSA-N |
| SMILES | CC(=O)CC(C1=NC=CN1C)(C(F)(F)F)O |
Computed by PubChem (NCBI)