CAS 93060-34-5 is the registry number for 1,2,4-Triazine-3,5-dione 2-β-D-xylopyranoside. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[(2R,3R,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,2,4-triazine-3,5-dione (CAS 93060-34-5) is a chemical compound with the molecular formula C8H11N3O6 and a molecular weight of 245.19 g/mol. IUPAC name: 2-[(2R,3R,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,2,4-triazine-3,5-dione. InChIKey: WYXSYVWAUAUWLD-VYNVVFCLSA-N.
| Molecular formula | C8H11N3O6 |
|---|---|
| Molecular weight | 245.19 g/mol |
| IUPAC name | 2-[(2R,3R,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,2,4-triazine-3,5-dione |
| InChIKey | WYXSYVWAUAUWLD-VYNVVFCLSA-N |
| SMILES | C1=NN(C(=O)NC1=O)[C@H]2[C@@H]([C@H]([C@H](O2)CO)O)O |
Computed by PubChem (NCBI)