Products 930652-01-0
CAS 930652-01-0 is the registry number for 4-Chloro-N-(2,4-dimethylphenyl)picolinamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-chloro-N-(2,4-dimethylphenyl)pyridine-2-carboxamide (CAS 930652-01-0) is a chemical compound with the molecular formula C14H13ClN2O and a molecular weight of 260.72 g/mol. IUPAC name: 4-chloro-N-(2,4-dimethylphenyl)pyridine-2-carboxamide. InChIKey: HMOGFNMTLFXXCM-UHFFFAOYSA-N.
| Molecular formula | C14H13ClN2O |
|---|---|
| Molecular weight | 260.72 g/mol |
| IUPAC name | 4-chloro-N-(2,4-dimethylphenyl)pyridine-2-carboxamide |
| InChIKey | HMOGFNMTLFXXCM-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)NC(=O)C2=NC=CC(=C2)Cl)C |
Computed by PubChem (NCBI)