CAS 932114-06-2 appears in our catalog under these names: Prucalopride Impurity 17, Prucalopride Impurity 31. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
4-acetamido-2,3-dihydro-1-benzofuran-7-carboxylic acid (CAS 932114-06-2) is a chemical compound with the molecular formula C11H11NO4 and a molecular weight of 221.21 g/mol. IUPAC name: 4-acetamido-2,3-dihydro-1-benzofuran-7-carboxylic acid. InChIKey: UUDBWEMKJSBSQL-UHFFFAOYSA-N.
| Molecular formula | C11H11NO4 |
|---|---|
| Molecular weight | 221.21 g/mol |
| IUPAC name | 4-acetamido-2,3-dihydro-1-benzofuran-7-carboxylic acid |
| InChIKey | UUDBWEMKJSBSQL-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=C2CCOC2=C(C=C1)C(=O)O |
Computed by PubChem (NCBI)