CAS 932279-51-1 is the registry number for 2-[(4-Ethoxyphenyl)amino]-5,6-dimethylpyrimidin-4(3h)-one, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-(4-ethoxyanilino)-4,5-dimethyl-1H-pyrimidin-6-one (CAS 932279-51-1) is a chemical compound with the molecular formula C14H17N3O2 and a molecular weight of 259.30 g/mol. IUPAC name: 2-(4-ethoxyanilino)-4,5-dimethyl-1H-pyrimidin-6-one. InChIKey: BRHQDJCXCDWZJO-UHFFFAOYSA-N.
| Molecular formula | C14H17N3O2 |
|---|---|
| Molecular weight | 259.30 g/mol |
| IUPAC name | 2-(4-ethoxyanilino)-4,5-dimethyl-1H-pyrimidin-6-one |
| InChIKey | BRHQDJCXCDWZJO-UHFFFAOYSA-N |
| SMILES | CCOC1=CC=C(C=C1)NC2=NC(=C(C(=O)N2)C)C |
Computed by PubChem (NCBI)