Products 932373-72-3
CAS 932373-72-3 appears in our catalog under these names: 2,3-Difluoro-1-methyl-4-nitrobenzene 98%, 2，3-Difluoro-1-methyl-4-nitrobenzene, 98%, 98%, 2,3-Difluoro-1-methyl-4-nitrobenzene, 98%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g.
2,3-difluoro-1-methyl-4-nitrobenzene (CAS 932373-72-3) is a chemical compound with the molecular formula C7H5F2NO2 and a molecular weight of 173.12 g/mol. IUPAC name: 2,3-difluoro-1-methyl-4-nitrobenzene. InChIKey: DQKUCXAFYAIKFJ-UHFFFAOYSA-N.
| Molecular formula | C7H5F2NO2 |
|---|---|
| Molecular weight | 173.12 g/mol |
| IUPAC name | 2,3-difluoro-1-methyl-4-nitrobenzene |
| InChIKey | DQKUCXAFYAIKFJ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)[N+](=O)[O-])F)F |
Computed by PubChem (NCBI)