CAS 93315-38-9 is the registry number for 1-(1-Benzyl-1H-indol-3-yl)ethanone. Offered by: Biosynth. Available pack sizes: 500mg, 1000mg, 2000mg, 5000mg.
1-(1-benzylindol-3-yl)ethanone (CAS 93315-38-9) is a chemical compound with the molecular formula C17H15NO and a molecular weight of 249.31 g/mol. IUPAC name: 1-(1-benzylindol-3-yl)ethanone. InChIKey: ZKPMMGGHAVKPPN-UHFFFAOYSA-N.
| Molecular formula | C17H15NO |
|---|---|
| Molecular weight | 249.31 g/mol |
| IUPAC name | 1-(1-benzylindol-3-yl)ethanone |
| InChIKey | ZKPMMGGHAVKPPN-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CN(C2=CC=CC=C21)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)