Products 933696-01-6
CAS 933696-01-6 is the registry number for 2(1H)-Isoquinolinepropanoic acid, 3,4-dihydro-1-oxo-, >97%. Offered by: Chemat. Available pack sizes: 50mg, 100mg, 250mg.
3-(1-oxo-3,4-dihydroisoquinolin-2-yl)propanoic acid (CAS 933696-01-6) is a chemical compound with the molecular formula C12H13NO3 and a molecular weight of 219.24 g/mol. IUPAC name: 3-(1-oxo-3,4-dihydroisoquinolin-2-yl)propanoic acid. InChIKey: XUIBJDVGZQVAFD-UHFFFAOYSA-N.
| Molecular formula | C12H13NO3 |
|---|---|
| Molecular weight | 219.24 g/mol |
| IUPAC name | 3-(1-oxo-3,4-dihydroisoquinolin-2-yl)propanoic acid |
| InChIKey | XUIBJDVGZQVAFD-UHFFFAOYSA-N |
| SMILES | C1CN(C(=O)C2=CC=CC=C21)CCC(=O)O |
Computed by PubChem (NCBI)