CAS 933705-21-6 appears in our catalog under these names: Glipizide Impurity 20, Glipizide Impurity 3, 2-(2-Aminoethyl)benzenesulfonamide. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 0,5g, 50mg.
2-(2-aminoethyl)benzenesulfonamide (CAS 933705-21-6) is a chemical compound with the molecular formula C8H12N2O2S and a molecular weight of 200.26 g/mol. IUPAC name: 2-(2-aminoethyl)benzenesulfonamide. InChIKey: XNMHWEWCCHMGDY-UHFFFAOYSA-N.
| Molecular formula | C8H12N2O2S |
|---|---|
| Molecular weight | 200.26 g/mol |
| IUPAC name | 2-(2-aminoethyl)benzenesulfonamide |
| InChIKey | XNMHWEWCCHMGDY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CCN)S(=O)(=O)N |
Computed by PubChem (NCBI)