Products 933707-71-2
CAS 933707-71-2 is the registry number for 3-(4-Methyl-1H-1,3-benzodiazol-2-yl)propanoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-(4-methyl-1H-benzimidazol-2-yl)propanoic acid (CAS 933707-71-2) is a chemical compound with the molecular formula C11H12N2O2 and a molecular weight of 204.22 g/mol. IUPAC name: 3-(4-methyl-1H-benzimidazol-2-yl)propanoic acid. InChIKey: HPIQKIKYAJGDAX-UHFFFAOYSA-N.
| Molecular formula | C11H12N2O2 |
|---|---|
| Molecular weight | 204.22 g/mol |
| IUPAC name | 3-(4-methyl-1H-benzimidazol-2-yl)propanoic acid |
| InChIKey | HPIQKIKYAJGDAX-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC=C1)NC(=N2)CCC(=O)O |
Computed by PubChem (NCBI)