Products 933730-03-1
CAS 933730-03-1 is the registry number for 2-Bromo-1H-benzimidazole-6-carboxylic acid. Offered by: Biosynth. Available pack sizes: 100mg, 50mg, 250mg, 1000mg, 500mg.
2-bromo-3H-benzimidazole-5-carboxylic acid (CAS 933730-03-1) is a chemical compound with the molecular formula C8H5BrN2O2 and a molecular weight of 241.04 g/mol. IUPAC name: 2-bromo-3H-benzimidazole-5-carboxylic acid. InChIKey: QYNMDHIBASYCCA-UHFFFAOYSA-N.
| Molecular formula | C8H5BrN2O2 |
|---|---|
| Molecular weight | 241.04 g/mol |
| IUPAC name | 2-bromo-3H-benzimidazole-5-carboxylic acid |
| InChIKey | QYNMDHIBASYCCA-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(=O)O)NC(=N2)Br |
Computed by PubChem (NCBI)