Products 933740-08-0
CAS 933740-08-0 is the registry number for 3-(2-Oxo-1,2,3,4-tetrahydroquinolin-1-yl)propanoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-(2-oxo-3,4-dihydroquinolin-1-yl)propanoic acid (CAS 933740-08-0) is a chemical compound with the molecular formula C12H13NO3 and a molecular weight of 219.24 g/mol. IUPAC name: 3-(2-oxo-3,4-dihydroquinolin-1-yl)propanoic acid. InChIKey: YBSBSZPGEZVFTN-UHFFFAOYSA-N.
| Molecular formula | C12H13NO3 |
|---|---|
| Molecular weight | 219.24 g/mol |
| IUPAC name | 3-(2-oxo-3,4-dihydroquinolin-1-yl)propanoic acid |
| InChIKey | YBSBSZPGEZVFTN-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C2=CC=CC=C21)CCC(=O)O |
Computed by PubChem (NCBI)