Products 933759-95-6

CAS 933759-95-6 is the registry number for 3,7-Dimethyl-1H-indole-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

3,7-dimethyl-1H-indole-2-carboxylic acid (CAS 933759-95-6) is a chemical compound with the molecular formula C11H11NO2 and a molecular weight of 189.21 g/mol. IUPAC name: 3,7-dimethyl-1H-indole-2-carboxylic acid. InChIKey: PDIMPZYTLFMVNW-UHFFFAOYSA-N.

Identity
Molecular formulaC11H11NO2
Molecular weight189.21 g/mol
IUPAC name3,7-dimethyl-1H-indole-2-carboxylic acid
InChIKeyPDIMPZYTLFMVNW-UHFFFAOYSA-N
SMILESCC1=C2C(=CC=C1)C(=C(N2)C(=O)O)C

Computed by PubChem (NCBI)