Products 934188-81-5
CAS 934188-81-5 is the registry number for (5-(2,4-Difluorophenyl)-1,2-oxazol-3-yl)methanol. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
[5-(2,4-difluorophenyl)-1,2-oxazol-3-yl]methanol (CAS 934188-81-5) is a chemical compound with the molecular formula C10H7F2NO2 and a molecular weight of 211.16 g/mol. IUPAC name: [5-(2,4-difluorophenyl)-1,2-oxazol-3-yl]methanol. InChIKey: ULPAADJUUMKRRS-UHFFFAOYSA-N.
| Molecular formula | C10H7F2NO2 |
|---|---|
| Molecular weight | 211.16 g/mol |
| IUPAC name | [5-(2,4-difluorophenyl)-1,2-oxazol-3-yl]methanol |
| InChIKey | ULPAADJUUMKRRS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)F)C2=CC(=NO2)CO |
Computed by PubChem (NCBI)