CAS 934607-42-8 is the registry number for N-Hydroxy-4-methoxy-2-methylbenzimidamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N'-hydroxy-4-methoxy-2-methylbenzenecarboximidamide (CAS 934607-42-8) is a chemical compound with the molecular formula C9H12N2O2 and a molecular weight of 180.20 g/mol. IUPAC name: N'-hydroxy-4-methoxy-2-methylbenzenecarboximidamide. InChIKey: GUABQMYWELPNOR-UHFFFAOYSA-N.
| Molecular formula | C9H12N2O2 |
|---|---|
| Molecular weight | 180.20 g/mol |
| IUPAC name | N'-hydroxy-4-methoxy-2-methylbenzenecarboximidamide |
| InChIKey | GUABQMYWELPNOR-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)OC)C(=NO)N |
Computed by PubChem (NCBI)