CAS 93468-79-2 is the registry number for 2-(Dimethylamino)-4-methoxythiazole-5-carbaldehyde, 97%. Offered by: AmBeed. Available pack sizes: 5g.
2-chloro-N-[(2,4-dimethylphenyl)carbamoyl]acetamide (CAS 93468-79-2) is a chemical compound with the molecular formula C11H13ClN2O2 and a molecular weight of 240.68 g/mol. IUPAC name: 2-chloro-N-[(2,4-dimethylphenyl)carbamoyl]acetamide. InChIKey: IQRUGDDTVXVWQY-UHFFFAOYSA-N.
| Molecular formula | C11H13ClN2O2 |
|---|---|
| Molecular weight | 240.68 g/mol |
| IUPAC name | 2-chloro-N-[(2,4-dimethylphenyl)carbamoyl]acetamide |
| InChIKey | IQRUGDDTVXVWQY-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)NC(=O)NC(=O)CCl)C |
Computed by PubChem (NCBI)