CAS 93484-84-5 is the registry number for (5-Bromo-4-methoxyphenyl)acetone. Offered by: Biosynth. Available pack sizes: 25g, 10g.
1-(3-bromo-4-methoxyphenyl)propan-2-one (CAS 93484-84-5) is a chemical compound with the molecular formula C10H11BrO2 and a molecular weight of 243.10 g/mol. IUPAC name: 1-(3-bromo-4-methoxyphenyl)propan-2-one. InChIKey: FUXDJXNPHSHGKZ-UHFFFAOYSA-N.
| Molecular formula | C10H11BrO2 |
|---|---|
| Molecular weight | 243.10 g/mol |
| IUPAC name | 1-(3-bromo-4-methoxyphenyl)propan-2-one |
| InChIKey | FUXDJXNPHSHGKZ-UHFFFAOYSA-N |
| SMILES | CC(=O)CC1=CC(=C(C=C1)OC)Br |
Computed by PubChem (NCBI)