Products 936497-94-8
CAS 936497-94-8 is the registry number for 4-Chloro-6,8-dimethyl-quinoline-3-carbonitrile. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
4-chloro-6,8-dimethylquinoline-3-carbonitrile (CAS 936497-94-8) is a chemical compound with the molecular formula C12H9ClN2 and a molecular weight of 216.66 g/mol. IUPAC name: 4-chloro-6,8-dimethylquinoline-3-carbonitrile. InChIKey: FTZUDIXIHZJVPM-UHFFFAOYSA-N.
| Molecular formula | C12H9ClN2 |
|---|---|
| Molecular weight | 216.66 g/mol |
| IUPAC name | 4-chloro-6,8-dimethylquinoline-3-carbonitrile |
| InChIKey | FTZUDIXIHZJVPM-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C(=C1)C(=C(C=N2)C#N)Cl)C |
Computed by PubChem (NCBI)