CAS 93669-49-9 appears in our catalog under these names: 2-Chloro-N,6-dimethyl-N-phenylpyrimidin-4-amine, 95%, 2-Chloro-N,6-dimethyl-N-phenylpyrimidin-4-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
2-chloro-N,6-dimethyl-N-phenylpyrimidin-4-amine (CAS 93669-49-9) is a chemical compound with the molecular formula C12H12ClN3 and a molecular weight of 233.69 g/mol. IUPAC name: 2-chloro-N,6-dimethyl-N-phenylpyrimidin-4-amine. InChIKey: NAORTSZWMACGDB-UHFFFAOYSA-N.
| Molecular formula | C12H12ClN3 |
|---|---|
| Molecular weight | 233.69 g/mol |
| IUPAC name | 2-chloro-N,6-dimethyl-N-phenylpyrimidin-4-amine |
| InChIKey | NAORTSZWMACGDB-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC(=N1)Cl)N(C)C2=CC=CC=C2 |
Computed by PubChem (NCBI)