Products 93669-68-2
CAS 93669-68-2 is the registry number for 4-Chloro-N,6-dimethyl-N-phenylpyrimidin-2-amine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-chloro-N,6-dimethyl-N-phenylpyrimidin-2-amine (CAS 93669-68-2) is a chemical compound with the molecular formula C12H12ClN3 and a molecular weight of 233.69 g/mol. IUPAC name: 4-chloro-N,6-dimethyl-N-phenylpyrimidin-2-amine. InChIKey: VSLQXADGAKIBPO-UHFFFAOYSA-N.
| Molecular formula | C12H12ClN3 |
|---|---|
| Molecular weight | 233.69 g/mol |
| IUPAC name | 4-chloro-N,6-dimethyl-N-phenylpyrimidin-2-amine |
| InChIKey | VSLQXADGAKIBPO-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC(=N1)N(C)C2=CC=CC=C2)Cl |
Computed by PubChem (NCBI)