CAS 93670-12-3 is the registry number for 5-Chloro-2,3-dihydro-1-benzofuran-3-carboxylic acid, 95%. Offered by: AmBeed. Available pack sizes: 1g, 5g.
5-chloro-2,3-dihydro-1-benzofuran-3-carboxylic acid (CAS 93670-12-3) is a chemical compound with the molecular formula C9H7ClO3 and a molecular weight of 198.60 g/mol. IUPAC name: 5-chloro-2,3-dihydro-1-benzofuran-3-carboxylic acid. InChIKey: NDFVCSLNRIFJJR-UHFFFAOYSA-N.
| Molecular formula | C9H7ClO3 |
|---|---|
| Molecular weight | 198.60 g/mol |
| IUPAC name | 5-chloro-2,3-dihydro-1-benzofuran-3-carboxylic acid |
| InChIKey | NDFVCSLNRIFJJR-UHFFFAOYSA-N |
| SMILES | C1C(C2=C(O1)C=CC(=C2)Cl)C(=O)O |
Computed by PubChem (NCBI)