CAS 937604-86-9 is the registry number for 2-(3-Chloro-5-(trifluoromethyl)(2-pyridyl)oxy)-3-methoxybenzaldehyde. Offered by: Biosynth. Available pack sizes: 10mg, 5mg, 25mg.
2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-3-methoxybenzaldehyde (CAS 937604-86-9) is a chemical compound with the molecular formula C14H9ClF3NO3 and a molecular weight of 331.67 g/mol. IUPAC name: 2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-3-methoxybenzaldehyde. InChIKey: WJUNWBBYGDEOLG-UHFFFAOYSA-N.
| Molecular formula | C14H9ClF3NO3 |
|---|---|
| Molecular weight | 331.67 g/mol |
| IUPAC name | 2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-3-methoxybenzaldehyde |
| InChIKey | WJUNWBBYGDEOLG-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1OC2=C(C=C(C=N2)C(F)(F)F)Cl)C=O |
Computed by PubChem (NCBI)