Products 937609-49-9
CAS 937609-49-9 appears in our catalog under these names: 3-(3,4-Difluorobenzyl)azetidine, 97%, 3-((3,4-Difluorophenyl)methyl)azetidine. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 2,5g.
3-[(3,4-difluorophenyl)methyl]azetidine (CAS 937609-49-9) is a chemical compound with the molecular formula C10H11F2N and a molecular weight of 183.20 g/mol. IUPAC name: 3-[(3,4-difluorophenyl)methyl]azetidine. InChIKey: USSXSTMGXCZNMH-UHFFFAOYSA-N.
| Molecular formula | C10H11F2N |
|---|---|
| Molecular weight | 183.20 g/mol |
| IUPAC name | 3-[(3,4-difluorophenyl)methyl]azetidine |
| InChIKey | USSXSTMGXCZNMH-UHFFFAOYSA-N |
| SMILES | C1C(CN1)CC2=CC(=C(C=C2)F)F |
Computed by PubChem (NCBI)