CAS 937625-45-1 appears in our catalog under these names: 3-(2,4-Difluorobenzyl)azetidine, 97%, 3-((2,4-Difluorophenyl)methyl)azetidine. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 0,5g, 0,25g, 1g.
3-[(2,4-difluorophenyl)methyl]azetidine (CAS 937625-45-1) is a chemical compound with the molecular formula C10H11F2N and a molecular weight of 183.20 g/mol. IUPAC name: 3-[(2,4-difluorophenyl)methyl]azetidine. InChIKey: AROGWOXHPFKLRV-UHFFFAOYSA-N.
| Molecular formula | C10H11F2N |
|---|---|
| Molecular weight | 183.20 g/mol |
| IUPAC name | 3-[(2,4-difluorophenyl)methyl]azetidine |
| InChIKey | AROGWOXHPFKLRV-UHFFFAOYSA-N |
| SMILES | C1C(CN1)CC2=C(C=C(C=C2)F)F |
Computed by PubChem (NCBI)