CAS 937642-75-6 is the registry number for 3-(2-(3-Chlorophenyl)ethyl)-2-pyridinecarboxamide. Offered by: Chemat Brand, Mikromol. Available pack sizes: on request, 25mg.
3-[2-(3-chlorophenyl)ethyl]pyridine-2-carboxamide (CAS 937642-75-6) is a chemical compound with the molecular formula C14H13ClN2O and a molecular weight of 260.72 g/mol. IUPAC name: 3-[2-(3-chlorophenyl)ethyl]pyridine-2-carboxamide. InChIKey: VJHDALMAOZECTJ-UHFFFAOYSA-N.
| Molecular formula | C14H13ClN2O |
|---|---|
| Molecular weight | 260.72 g/mol |
| IUPAC name | 3-[2-(3-chlorophenyl)ethyl]pyridine-2-carboxamide |
| InChIKey | VJHDALMAOZECTJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)CCC2=C(N=CC=C2)C(=O)N |
Computed by PubChem (NCBI)