CAS 93794-39-9 is the registry number for 2-Chloro-6-methoxybenzo(d)oxazole, 97%. Offered by: AmBeed. Available pack sizes: 1g.
2-chloro-6-methoxy-1,3-benzoxazole (CAS 93794-39-9) is a chemical compound with the molecular formula C8H6ClNO2 and a molecular weight of 183.59 g/mol. IUPAC name: 2-chloro-6-methoxy-1,3-benzoxazole. InChIKey: SCMOOWBWHIIZBM-UHFFFAOYSA-N.
| Molecular formula | C8H6ClNO2 |
|---|---|
| Molecular weight | 183.59 g/mol |
| IUPAC name | 2-chloro-6-methoxy-1,3-benzoxazole |
| InChIKey | SCMOOWBWHIIZBM-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)N=C(O2)Cl |
Computed by PubChem (NCBI)