CAS 938063-51-5 appears in our catalog under these names: 4-tert-Butoxybenzeneboronic acid, pinacol ester, 95-<97%, 4-tert-Butoxybenzeneboronic acid, pinacol ester, ≥97-<99%, 4–(tert–Butoxy)phenylboronic Acid Pinacol Ester, 2-(4-(tert-Butoxy)phenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 97%, 97%, 2-(4-(tert-Butoxy)phenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 97%. Offered by: Hoffman Fine Chemicals, GLPBio, Chemat, Fluorochem. Available pack sizes: 25g, 50g, 100g, 200g, 300g, 400g, 1g, 5g.
4,4,5,5-tetramethyl-2-[4-[(2-methylpropan-2-yl)oxy]phenyl]-1,3,2-dioxaborolane (CAS 938063-51-5) is a chemical compound with the molecular formula C16H25BO3 and a molecular weight of 276.2 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-[4-[(2-methylpropan-2-yl)oxy]phenyl]-1,3,2-dioxaborolane. InChIKey: MJXCVJJOCYCOQE-UHFFFAOYSA-N.
| Molecular formula | C16H25BO3 |
|---|---|
| Molecular weight | 276.2 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-[4-[(2-methylpropan-2-yl)oxy]phenyl]-1,3,2-dioxaborolane |
| InChIKey | MJXCVJJOCYCOQE-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)OC(C)(C)C |
Computed by PubChem (NCBI)