CAS 93940-19-3 appears in our catalog under these names: Tranexamic Acid EP Impurity A, Tranexamic Acid Dimer, >95% (HPLC), trans-trans-4,4'-Iminodimethylenedi(cyclohexanecarboxylic acid), (trans,trans)-4,4'-(Azanediylbis(methylene))dicyclohexanecarboxylic acid 95+%, DITRANEXAMIC ACID AMINE. Offered by: Chemat Brand, TRC, Biosynth, Ambeed, Sigma-Aldrich. Available pack sizes: on request, 2,5mg, 25mg, 5mg, 2mg, 10mg, 50mg, 100mg.
4-[[(4-carboxycyclohexyl)methylamino]methyl]cyclohexane-1-carboxylic acid (CAS 93940-19-3) is a chemical compound with the molecular formula C16H27NO4 and a molecular weight of 297.39 g/mol. IUPAC name: 4-[[(4-carboxycyclohexyl)methylamino]methyl]cyclohexane-1-carboxylic acid. InChIKey: XHPXSMWMAJGYBS-UHFFFAOYSA-N.
| Molecular formula | C16H27NO4 |
|---|---|
| Molecular weight | 297.39 g/mol |
| IUPAC name | 4-[[(4-carboxycyclohexyl)methylamino]methyl]cyclohexane-1-carboxylic acid |
| InChIKey | XHPXSMWMAJGYBS-UHFFFAOYSA-N |
| SMILES | C1CC(CCC1CNCC2CCC(CC2)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)