Products 93946-44-2
CAS 93946-44-2 is the registry number for 2-(Benzylamino)-1-(3-chlorophenyl)ethan-1-ol. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-(benzylamino)-1-(3-chlorophenyl)ethanol (CAS 93946-44-2) is a chemical compound with the molecular formula C15H16ClNO and a molecular weight of 261.74 g/mol. IUPAC name: 2-(benzylamino)-1-(3-chlorophenyl)ethanol. InChIKey: TZEGKWSSUBLZGT-UHFFFAOYSA-N.
| Molecular formula | C15H16ClNO |
|---|---|
| Molecular weight | 261.74 g/mol |
| IUPAC name | 2-(benzylamino)-1-(3-chlorophenyl)ethanol |
| InChIKey | TZEGKWSSUBLZGT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CNCC(C2=CC(=CC=C2)Cl)O |
Computed by PubChem (NCBI)