Products 939986-73-9
CAS 939986-73-9 is the registry number for 1-(6-Chloropyrimidin-4-Yl)Piperidin-3-Ol, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-(6-chloropyrimidin-4-yl)piperidin-3-ol (CAS 939986-73-9) is a chemical compound with the molecular formula C9H12ClN3O and a molecular weight of 213.66 g/mol. IUPAC name: 1-(6-chloropyrimidin-4-yl)piperidin-3-ol. InChIKey: RVIPRLBRGJPOIM-UHFFFAOYSA-N.
| Molecular formula | C9H12ClN3O |
|---|---|
| Molecular weight | 213.66 g/mol |
| IUPAC name | 1-(6-chloropyrimidin-4-yl)piperidin-3-ol |
| InChIKey | RVIPRLBRGJPOIM-UHFFFAOYSA-N |
| SMILES | C1CC(CN(C1)C2=CC(=NC=N2)Cl)O |
Computed by PubChem (NCBI)