Products 94099-63-5
CAS 94099-63-5 is the registry number for 2-Hydroxy-1,3,4-trimethoxyanthraquinone. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-hydroxy-1,3,4-trimethoxyanthracene-9,10-dione (CAS 94099-63-5) is a chemical compound with the molecular formula C17H14O6 and a molecular weight of 314.29 g/mol. IUPAC name: 2-hydroxy-1,3,4-trimethoxyanthracene-9,10-dione. InChIKey: GNDKMLNOKPZDHG-UHFFFAOYSA-N.
| Molecular formula | C17H14O6 |
|---|---|
| Molecular weight | 314.29 g/mol |
| IUPAC name | 2-hydroxy-1,3,4-trimethoxyanthracene-9,10-dione |
| InChIKey | GNDKMLNOKPZDHG-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C2=C1C(=O)C3=CC=CC=C3C2=O)OC)OC)O |
Computed by PubChem (NCBI)