CAS 941116-96-7 appears in our catalog under these names: Methyl 4-(2-amino-4-chlorophenoxy)benzoate, 97%, Methyl 4-(2-amino-4-chlorophenoxy)benzoate. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
Methyl 4-(2-amino-4-chlorophenoxy)benzoate (CAS 941116-96-7) is a chemical compound with the molecular formula C14H12ClNO3 and a molecular weight of 277.70 g/mol. IUPAC name: methyl 4-(2-amino-4-chlorophenoxy)benzoate. InChIKey: RUJXFGRLQBEHGL-UHFFFAOYSA-N.
| Molecular formula | C14H12ClNO3 |
|---|---|
| Molecular weight | 277.70 g/mol |
| IUPAC name | methyl 4-(2-amino-4-chlorophenoxy)benzoate |
| InChIKey | RUJXFGRLQBEHGL-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)OC2=C(C=C(C=C2)Cl)N |
Computed by PubChem (NCBI)