CAS 941266-27-9 appears in our catalog under these names: 2,2,4-Trimethyl-1,2-dihydroquinoline-8-carboxylic acid, 95%, 2,2,4-Trimethyl-1,2-dihydroquinoline-8-carboxylic acid, 95%, 95%. Offered by: Combi-blocks, Chemat, Ambeed. Available pack sizes: 250mg, 1g, 100mg.
2,2,4-trimethyl-1H-quinoline-8-carboxylic acid (CAS 941266-27-9) is a chemical compound with the molecular formula C13H15NO2 and a molecular weight of 217.26 g/mol. IUPAC name: 2,2,4-trimethyl-1H-quinoline-8-carboxylic acid. InChIKey: XEJWPMCWXLNOMT-UHFFFAOYSA-N.
| Molecular formula | C13H15NO2 |
|---|---|
| Molecular weight | 217.26 g/mol |
| IUPAC name | 2,2,4-trimethyl-1H-quinoline-8-carboxylic acid |
| InChIKey | XEJWPMCWXLNOMT-UHFFFAOYSA-N |
| SMILES | CC1=CC(NC2=C1C=CC=C2C(=O)O)(C)C |
Computed by PubChem (NCBI)