CAS 94154-89-9 appears in our catalog under these names: Oseltamivir Impurity 45, Barbituric Acid Impurity 1, 1,3-Dimethyl-5-(2-propen-1-yl)-2,4,6(1H,3H,5H)-pyrimidinetrione, 1,3-Dimethyl-5-(2-propen-1-yl)-2,4,6(1H,3H,5H)-pyrimidinetrione, 98%, 98%, 5-Allyl-1,3-dimethylpyrimidine-2,4,6(1H,3H,5H)-trione, Oseltamivir Impuruity, 98%. Offered by: Chemat Brand, Hubei YoungXin, TRC, Chemat, Fluorochem. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 250mg.
1,3-dimethyl-5-prop-2-enyl-1,3-diazinane-2,4,6-trione (CAS 94154-89-9) is a chemical compound with the molecular formula C9H12N2O3 and a molecular weight of 196.20 g/mol. IUPAC name: 1,3-dimethyl-5-prop-2-enyl-1,3-diazinane-2,4,6-trione. InChIKey: XKKYHHDOECFOHN-UHFFFAOYSA-N.
| Molecular formula | C9H12N2O3 |
|---|---|
| Molecular weight | 196.20 g/mol |
| IUPAC name | 1,3-dimethyl-5-prop-2-enyl-1,3-diazinane-2,4,6-trione |
| InChIKey | XKKYHHDOECFOHN-UHFFFAOYSA-N |
| SMILES | CN1C(=O)C(C(=O)N(C1=O)C)CC=C |
Computed by PubChem (NCBI)