CAS 942-72-3 appears in our catalog under these names: 6-Phenyl-1,2,4-triazin-3-amine, 6-Phenyl-1,2,4-triazin-3-amine, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 1g.
6-phenyl-1,2,4-triazin-3-amine (CAS 942-72-3) is a chemical compound with the molecular formula C9H8N4 and a molecular weight of 172.19 g/mol. IUPAC name: 6-phenyl-1,2,4-triazin-3-amine. InChIKey: NIJQGEJYKLRADI-UHFFFAOYSA-N.
| Molecular formula | C9H8N4 |
|---|---|
| Molecular weight | 172.19 g/mol |
| IUPAC name | 6-phenyl-1,2,4-triazin-3-amine |
| InChIKey | NIJQGEJYKLRADI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CN=C(N=N2)N |
Computed by PubChem (NCBI)