CAS 94200-14-3 is the registry number for Orciprenaline sulfate EP Impurity B. Offered by: Chemat Brand. Available pack sizes: on request.
1-(3,5-dihydroxyphenyl)-2-(propan-2-ylamino)ethanone (CAS 94200-14-3) is a chemical compound with the molecular formula C11H15NO3 and a molecular weight of 209.24 g/mol. IUPAC name: 1-(3,5-dihydroxyphenyl)-2-(propan-2-ylamino)ethanone. InChIKey: KCCKOYJILFTTCR-UHFFFAOYSA-N.
| Molecular formula | C11H15NO3 |
|---|---|
| Molecular weight | 209.24 g/mol |
| IUPAC name | 1-(3,5-dihydroxyphenyl)-2-(propan-2-ylamino)ethanone |
| InChIKey | KCCKOYJILFTTCR-UHFFFAOYSA-N |
| SMILES | CC(C)NCC(=O)C1=CC(=CC(=C1)O)O |
Computed by PubChem (NCBI)