Products 94200-14-3

CAS 94200-14-3 is the registry number for Orciprenaline sulfate EP Impurity B. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

1-(3,5-dihydroxyphenyl)-2-(propan-2-ylamino)ethanone (CAS 94200-14-3) is a chemical compound with the molecular formula C11H15NO3 and a molecular weight of 209.24 g/mol. IUPAC name: 1-(3,5-dihydroxyphenyl)-2-(propan-2-ylamino)ethanone. InChIKey: KCCKOYJILFTTCR-UHFFFAOYSA-N.

Identity
Molecular formulaC11H15NO3
Molecular weight209.24 g/mol
IUPAC name1-(3,5-dihydroxyphenyl)-2-(propan-2-ylamino)ethanone
InChIKeyKCCKOYJILFTTCR-UHFFFAOYSA-N
SMILESCC(C)NCC(=O)C1=CC(=CC(=C1)O)O

Computed by PubChem (NCBI)