Products 942296-18-6
CAS 942296-18-6 appears in our catalog under these names: AHL modulator–1, AHL modulator-1, 99.15%, 2-bromo-N-[(3S)-tetrahydro-2-oxo-3-furanyl]-Benzeneacetamide, ≥97%. Offered by: GLPBio, MedChemExpress, Chemat. Available pack sizes: 10mg, 5mg, 10 mg, 5 mg, 25 mg, 50 mg.
2-(2-bromophenyl)-N-[(3S)-2-oxooxolan-3-yl]acetamide (CAS 942296-18-6) is a chemical compound with the molecular formula C12H12BrNO3 and a molecular weight of 298.13 g/mol. IUPAC name: 2-(2-bromophenyl)-N-[(3S)-2-oxooxolan-3-yl]acetamide. InChIKey: MMJSTOMMZPSKSQ-JTQLQIEISA-N.
| Molecular formula | C12H12BrNO3 |
|---|---|
| Molecular weight | 298.13 g/mol |
| IUPAC name | 2-(2-bromophenyl)-N-[(3S)-2-oxooxolan-3-yl]acetamide |
| InChIKey | MMJSTOMMZPSKSQ-JTQLQIEISA-N |
| SMILES | C1COC(=O)[C@H]1NC(=O)CC2=CC=CC=C2Br |
Computed by PubChem (NCBI)