Products 942485-40-7

CAS 942485-40-7 appears in our catalog under these names: 3-(2,5-Difluorophenoxy)propanoic acid, 95%, 3-(2,5-Difluorophenoxy)propanoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 2,5g.

Structural formula: {0} (CAS {1})

3-(2,5-difluorophenoxy)propanoic acid (CAS 942485-40-7) is a chemical compound with the molecular formula C9H8F2O3 and a molecular weight of 202.15 g/mol. IUPAC name: 3-(2,5-difluorophenoxy)propanoic acid. InChIKey: KWZZGDYPPDQVSB-UHFFFAOYSA-N.

Identity
Molecular formulaC9H8F2O3
Molecular weight202.15 g/mol
IUPAC name3-(2,5-difluorophenoxy)propanoic acid
InChIKeyKWZZGDYPPDQVSB-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1F)OCCC(=O)O)F

Computed by PubChem (NCBI)