CAS 942661-43-0 is the registry number for 3-Bromo-N-(isoxazol-3-yl)benzamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-bromo-N-(1,2-oxazol-3-yl)benzamide (CAS 942661-43-0) is a chemical compound with the molecular formula C10H7BrN2O2 and a molecular weight of 267.08 g/mol. IUPAC name: 3-bromo-N-(1,2-oxazol-3-yl)benzamide. InChIKey: JZQULMLKDQECIE-UHFFFAOYSA-N.
| Molecular formula | C10H7BrN2O2 |
|---|---|
| Molecular weight | 267.08 g/mol |
| IUPAC name | 3-bromo-N-(1,2-oxazol-3-yl)benzamide |
| InChIKey | JZQULMLKDQECIE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)C(=O)NC2=NOC=C2 |
Computed by PubChem (NCBI)