CAS 94268-29-8 appears in our catalog under these names: 4-(Azetidin-3-yl)benzonitrile hydrochloride, 4-(Azetidin-3-yl)benzonitrile hydrochloride, 95%, 95%, Benzonitrile, 4-(3-azetidinyl)-, hydrochloride (1:1), 95%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 50mg, 0,5g, 100mg, 1g, 250mg, 5g.
4-(azetidin-3-yl)benzonitrile;hydrochloride (CAS 94268-29-8) is a chemical compound with the molecular formula C10H11ClN2 and a molecular weight of 194.66 g/mol. IUPAC name: 4-(azetidin-3-yl)benzonitrile;hydrochloride. InChIKey: OUCUIYOUNRIDRM-UHFFFAOYSA-N.
| Molecular formula | C10H11ClN2 |
|---|---|
| Molecular weight | 194.66 g/mol |
| IUPAC name | 4-(azetidin-3-yl)benzonitrile;hydrochloride |
| InChIKey | OUCUIYOUNRIDRM-UHFFFAOYSA-N |
| SMILES | C1C(CN1)C2=CC=C(C=C2)C#N.Cl |
Computed by PubChem (NCBI)