CAS 942922-74-9 is the registry number for Methyl Picolinate Dimer 1. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 4-(2-methoxycarbonyl-4-pyridinyl)pyridine-2-carboxylate (CAS 942922-74-9) is a chemical compound with the molecular formula C14H12N2O4 and a molecular weight of 272.26 g/mol. IUPAC name: methyl 4-(2-methoxycarbonyl-4-pyridinyl)pyridine-2-carboxylate. InChIKey: AABONNZLGFYNCO-UHFFFAOYSA-N.
| Molecular formula | C14H12N2O4 |
|---|---|
| Molecular weight | 272.26 g/mol |
| IUPAC name | methyl 4-(2-methoxycarbonyl-4-pyridinyl)pyridine-2-carboxylate |
| InChIKey | AABONNZLGFYNCO-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=NC=CC(=C1)C2=CC(=NC=C2)C(=O)OC |
Computed by PubChem (NCBI)