Products 942922-74-9

CAS 942922-74-9 is the registry number for Methyl Picolinate Dimer 1. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Methyl 4-(2-methoxycarbonyl-4-pyridinyl)pyridine-2-carboxylate (CAS 942922-74-9) is a chemical compound with the molecular formula C14H12N2O4 and a molecular weight of 272.26 g/mol. IUPAC name: methyl 4-(2-methoxycarbonyl-4-pyridinyl)pyridine-2-carboxylate. InChIKey: AABONNZLGFYNCO-UHFFFAOYSA-N.

Identity
Molecular formulaC14H12N2O4
Molecular weight272.26 g/mol
IUPAC namemethyl 4-(2-methoxycarbonyl-4-pyridinyl)pyridine-2-carboxylate
InChIKeyAABONNZLGFYNCO-UHFFFAOYSA-N
SMILESCOC(=O)C1=NC=CC(=C1)C2=CC(=NC=C2)C(=O)OC

Computed by PubChem (NCBI)