Products 943113-44-8

CAS 943113-44-8 is the registry number for 1-(Oxolan-2-ylmethyl)-1H-1,3-benzodiazole-5-carboxylic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.

Structural formula: {0} (CAS {1})

1-(oxolan-2-ylmethyl)benzimidazole-5-carboxylic acid (CAS 943113-44-8) is a chemical compound with the molecular formula C13H14N2O3 and a molecular weight of 246.26 g/mol. IUPAC name: 1-(oxolan-2-ylmethyl)benzimidazole-5-carboxylic acid. InChIKey: MKCURZWODSHALM-UHFFFAOYSA-N.

Identity
Molecular formulaC13H14N2O3
Molecular weight246.26 g/mol
IUPAC name1-(oxolan-2-ylmethyl)benzimidazole-5-carboxylic acid
InChIKeyMKCURZWODSHALM-UHFFFAOYSA-N
SMILESC1CC(OC1)CN2C=NC3=C2C=CC(=C3)C(=O)O

Computed by PubChem (NCBI)