CAS 943409-69-6 is the registry number for Ethyl p-nitrobenzyl carbonate. Offered by: Biosynth. Available pack sizes: 25mg, 10mg, 50mg.
(4-nitrophenyl)methyl N-ethylcarbamate (CAS 943409-69-6) is a chemical compound with the molecular formula C10H12N2O4 and a molecular weight of 224.21 g/mol. IUPAC name: (4-nitrophenyl)methyl N-ethylcarbamate. InChIKey: NSBVDAMBDUXZAS-UHFFFAOYSA-N.
| Molecular formula | C10H12N2O4 |
|---|---|
| Molecular weight | 224.21 g/mol |
| IUPAC name | (4-nitrophenyl)methyl N-ethylcarbamate |
| InChIKey | NSBVDAMBDUXZAS-UHFFFAOYSA-N |
| SMILES | CCNC(=O)OCC1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)