Products 943518-63-6
CAS 943518-63-6 appears in our catalog under these names: Itopride Impurity 14, Itopride Impurity A, Itopride Impurity 9, N-(4-Hydroxybenzyl)-3,4-dimethoxybenzamide, >95% (HPLC), N-(4-Hydroxybenzyl)-3,4-dimethoxybenzamide. Offered by: Chemat Brand, Hubei YoungXin, TRC, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1g.
N-[(4-hydroxyphenyl)methyl]-3,4-dimethoxybenzamide (CAS 943518-63-6) is a chemical compound with the molecular formula C16H17NO4 and a molecular weight of 287.31 g/mol. IUPAC name: N-[(4-hydroxyphenyl)methyl]-3,4-dimethoxybenzamide. InChIKey: PHBYSUZNPFHIIS-UHFFFAOYSA-N.
| Molecular formula | C16H17NO4 |
|---|---|
| Molecular weight | 287.31 g/mol |
| IUPAC name | N-[(4-hydroxyphenyl)methyl]-3,4-dimethoxybenzamide |
| InChIKey | PHBYSUZNPFHIIS-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C(=O)NCC2=CC=C(C=C2)O)OC |
Computed by PubChem (NCBI)
Synonyms:
n-(4-hydroxybenzyl)-3,4-dimethoxybenzamide, N-[(4-hydroxyphenyl)methyl]-3,4-dimethoxybenzamide, Itopride Impurity A, N-(4-hydroxybenzyl)-3,4-dimethoxy benzamide, Itopride Impurity 1, starbld0043419, PHBYSUZNPFHIIS-UHFFFAOYSA-N, N-(4-Hydroxy Benzyl)-3,4-Dimethoxy Benzamide, N-(4-Hydroxy benzyl)-3, 4-dimethoxy benzamide