CAS 750649-38-8 appears in our catalog under these names: (1R,3S)-3-(1,3-Dioxoisoindolin-2-yl)cyclohexyl acetate, 95%, (1R,3S)-3-(1,3-Dioxoisoindolin-2-yl)cyclohexyl acetate, 97%, (1R,3S)–3–(1,3–Dioxoisoindolin–2–yl)cyclohexyl acetate. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 1g, 5g, 100mg.
[(1R,3S)-3-(1,3-dioxoisoindol-2-yl)cyclohexyl] acetate (CAS 750649-38-8) is a chemical compound with the molecular formula C16H17NO4 and a molecular weight of 287.31 g/mol. IUPAC name: [(1R,3S)-3-(1,3-dioxoisoindol-2-yl)cyclohexyl] acetate. InChIKey: ZDNOUOSAVXNPDI-NWDGAFQWSA-N.
| Molecular formula | C16H17NO4 |
|---|---|
| Molecular weight | 287.31 g/mol |
| IUPAC name | [(1R,3S)-3-(1,3-dioxoisoindol-2-yl)cyclohexyl] acetate |
| InChIKey | ZDNOUOSAVXNPDI-NWDGAFQWSA-N |
| SMILES | CC(=O)O[C@@H]1CCC[C@@H](C1)N2C(=O)C3=CC=CC=C3C2=O |
Computed by PubChem (NCBI)