CAS 1221724-77-1 appears in our catalog under these names: 7-Methyl-1,3-dioxo-2-phenyl-octahydro-1h-isoindole-4-carboxylic acid, 95%, 7-Methyl-1,3-dioxo-2-phenyl-octahydro-1H-isoindole-4-carboxylic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 2,5g.
7-methyl-1,3-dioxo-2-phenyl-3a,4,5,6,7,7a-hexahydroisoindole-4-carboxylic acid (CAS 1221724-77-1) is a chemical compound with the molecular formula C16H17NO4 and a molecular weight of 287.31 g/mol. IUPAC name: 7-methyl-1,3-dioxo-2-phenyl-3a,4,5,6,7,7a-hexahydroisoindole-4-carboxylic acid. InChIKey: XZTIGXRGMUHWCL-UHFFFAOYSA-N.
| Molecular formula | C16H17NO4 |
|---|---|
| Molecular weight | 287.31 g/mol |
| IUPAC name | 7-methyl-1,3-dioxo-2-phenyl-3a,4,5,6,7,7a-hexahydroisoindole-4-carboxylic acid |
| InChIKey | XZTIGXRGMUHWCL-UHFFFAOYSA-N |
| SMILES | CC1CCC(C2C1C(=O)N(C2=O)C3=CC=CC=C3)C(=O)O |
Computed by PubChem (NCBI)