CAS 500728-32-5 appears in our catalog under these names: 4-[3-(Ethoxycarbonyl)-2,5-dimethyl-1h-pyrrol-1-yl]benzoic acid, 95%, 4-(3-(Ethoxycarbonyl)-2,5-dimethyl-1H-pyrrol-1-yl)benzoic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
4-(3-ethoxycarbonyl-2,5-dimethylpyrrol-1-yl)benzoic acid (CAS 500728-32-5) is a chemical compound with the molecular formula C16H17NO4 and a molecular weight of 287.31 g/mol. IUPAC name: 4-(3-ethoxycarbonyl-2,5-dimethylpyrrol-1-yl)benzoic acid. InChIKey: NPBGZYKFJSAZBV-UHFFFAOYSA-N.
| Molecular formula | C16H17NO4 |
|---|---|
| Molecular weight | 287.31 g/mol |
| IUPAC name | 4-(3-ethoxycarbonyl-2,5-dimethylpyrrol-1-yl)benzoic acid |
| InChIKey | NPBGZYKFJSAZBV-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N(C(=C1)C)C2=CC=C(C=C2)C(=O)O)C |
Computed by PubChem (NCBI)